3-TE | Names | IUPAC name 2-[4-Ethoxy-3-methoxy-5-(methylsulfanyl)phenyl]ethanamine | Identifiers | CAS Number | | 3D model (JSmol) | | ChEMBL | | ChemSpider | | | | UNII | | Key: LRYPRFGBZRIFIX-UHFFFAOYSA-N InChI=1S/C12H19NO2S/c1-4-15-12-10(14-2)7-9(5-6-13)8-11(12)16-3/h7-8H,4-6,13H2,1-3H3 | | Properties | Chemical formula | C12H19NO2S | Molar mass | 241.35 g·mol−1 | Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Infobox references | Chemical compound - Dosage: 60–80 mg
- Duration: 8–12 hours
- Effects: increased pleasure from art and music, lowering of pitch, and time distortion
| 4-TE | Names | IUPAC name 2-[4-(Ethylsulfanyl)-3,5-dimethoxyphenyl]ethanamine | Identifiers | | - 90109-49-2 N
| | | ChEMBL | | ChemSpider | | | | Key: JUZZKKJLOWQNPC-UHFFFAOYSA-N InChI=1S/C12H19NO2S/c1-4-16-12-10(14-2)7-9(5-6-13)8-11(12)15-3/h7-8H,4-6,13H2,1-3H3 | | Properties | | C12H19NO2S | Molar mass | 241.35 g·mol−1 | Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Infobox references | Chemical compound - Dosage: 20–30 mg
- Duration: 9–12 hours
- Effects: open-eye visuals, easy conversation. +++ on the Shulgin Rating Scale
|